C19H20ClN4O2+ — CID 135500045
4-[4-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-1H-pyrazol-5-yl]-6-chlorobenzene-1,3-diol (PubChem CID 135500045) has the molecular formula C19H20ClN4O2+ and a molecular weight of 371.85 g/mol. Its IUPAC name is 4-[4-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-1H-pyrazol-5-yl]-6-chlorobenzene-1,3-diol.
| Compound Name | 4-[4-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-1H-pyrazol-5-yl]-6-chlorobenzene-1,3-diol |
|---|---|
| PubChem CID | 135500045 |
| Molecular Formula | C19H20ClN4O2+ |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-[4-[4,4-bis(prop-2-ynyl)piperazin-4-ium-1-yl]-1H-pyrazol-5-yl]-6-chlorobenzene-1,3-diol |
| SMILES | C#CC[N+]1(CC#C)CCN(c2cn[nH]c2-c2cc(Cl)c(O)cc2O)CC1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-3-7-24(8-4-2)9-5-23(6-10-24)16-13-21-22-19(16)14-11-15(20)18(26)12-17(14)25/h1-2,11-13H,5-10H2,(H2-,21,22,25,26)/p+1 |
| InChIKey | QZRGOWDFECPMRS-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|