C15H21N3O2 — CID 135503338
3-hydroxy-N,N-dimethyl-2-[(4-propan-2-ylphenyl)diazenyl]but-2-enamide (PubChem CID 135503338) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-2-[(4-propan-2-ylphenyl)diazenyl]but-2-enamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-2-[(4-propan-2-ylphenyl)diazenyl]but-2-enamide |
|---|---|
| PubChem CID | 135503338 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-2-[(4-propan-2-ylphenyl)diazenyl]but-2-enamide |
| SMILES | CC(O)=C(/N=N/c1ccc(C(C)C)cc1)C(=O)N(C)C |
| InChI | InChI=1S/C15H21N3O2/c1-10(2)12-6-8-13(9-7-12)16-17-14(11(3)19)15(20)18(4)5/h6-10,19H,1-5H3/b14-11?,17-16+ |
| InChIKey | NGPUBEULZLDULU-DZJPBXMHSA-N |
| XLogP | 3.77 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|