C15H11N3O4S — CID 135504413
methyl (3E)-3-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylidene]indole-2-carboxylate (PubChem CID 135504413) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is methyl (3E)-3-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylidene]indole-2-carboxylate.
| Compound Name | methyl (3E)-3-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylidene]indole-2-carboxylate |
|---|---|
| PubChem CID | 135504413 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | methyl (3E)-3-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylidene]indole-2-carboxylate |
| SMILES | COC(=O)C1=Nc2ccccc2/C1=C\c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C15H11N3O4S/c1-22-14(21)11-8(7-4-2-3-5-10(7)16-11)6-9-12(19)17-15(23)18-13(9)20/h2-6H,1H3,(H3,17,18,19,20,23)/b8-6+ |
| InChIKey | XYUCOPLAFNNUEY-SOFGYWHQSA-N |
| XLogP | 1.94 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|