C25H24N2O4S2 — CID 135504643
4-methylbenzenesulfonate;2-[(E,3Z)-3-(3-methyl-1,3-thiazolidin-2-ylidene)prop-1-enyl]benzo[e][1,3]benzoxazol-1-ium (PubChem CID 135504643) has the molecular formula C25H24N2O4S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;2-[(E,3Z)-3-(3-methyl-1,3-thiazolidin-2-ylidene)prop-1-enyl]benzo[e][1,3]benzoxazol-1-ium.
| Compound Name | 4-methylbenzenesulfonate;2-[(E,3Z)-3-(3-methyl-1,3-thiazolidin-2-ylidene)prop-1-enyl]benzo[e][1,3]benzoxazol-1-ium |
|---|---|
| PubChem CID | 135504643 |
| Molecular Formula | C25H24N2O4S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-methylbenzenesulfonate;2-[(E,3Z)-3-(3-methyl-1,3-thiazolidin-2-ylidene)prop-1-enyl]benzo[e][1,3]benzoxazol-1-ium |
| SMILES | CN1CCS/C1=C\C=C\c1[nH+]c2c(ccc3ccccc32)o1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2OS.C7H8O3S/c1-20-11-12-22-17(20)8-4-7-16-19-18-14-6-3-2-5-13(14)9-10-15(18)21-16;1-6-2-4-7(5-3-6)11(8,9)10/h2-10H,11-12H2,1H3;2-5H,1H3,(H,8,9,10)/b7-4+,17-8-; |
| InChIKey | QHHMTNIUDJIHEJ-HWAGADLWSA-N |
| XLogP | 4.83 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|