C20H20N2O4S — CID 135505654
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 3-phenylprop-2-enoate (PubChem CID 135505654) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 3-phenylprop-2-enoate.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 135505654 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O4S/c23-19(13-12-16-8-2-1-3-9-16)26-15-7-6-14-21-20-17-10-4-5-11-18(17)27(24,25)22-20/h1-5,8-13H,6-7,14-15H2,(H,21,22) |
| InChIKey | GQZYLTJOBVBXKT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|