C25H26N8O4 — CID 135508756
2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135508756) has the molecular formula C25H26N8O4 and a molecular weight of 502.54 g/mol. Its IUPAC name is 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135508756 |
| Molecular Formula | C25H26N8O4 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Cc1ccnc2c1NC(=O)c1cccnc1N2C1CC1.O=c1[nH]cnc2c1ncn2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C15H14N4O.C10H12N4O3/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10;15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h2-3,6-8,10H,4-5H2,1H3,(H,18,20);4-7,15H,1-3H2,(H,11,12,16)/t;6-,7+/m.0/s1 |
| InChIKey | SAHXGRYWCJUSBC-HLISZSCWSA-N |
| XLogP | 2.44 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |