C33H32N4O — CID 135510036
(1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol (PubChem CID 135510036) has the molecular formula C33H32N4O and a molecular weight of 500.65 g/mol. Its IUPAC name is (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol.
| Compound Name | (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 135510036 |
| Molecular Formula | C33H32N4O |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (1Z)-1-[17,17-dimethyl-5-(2,4,6-trimethylphenyl)-18,24-dihydroporphyrin-2-ylidene]ethanol |
| SMILES | C/C(O)=C1\C=C2N=C1/C=C1/CC(C)(C)/C(=C/C3=N/C(=C\C4=N/C(=C\2c2c(C)cc(C)cc2C)C=C4)C=C3)N1 |
| InChI | InChI=1S/C33H32N4O/c1-18-11-19(2)31(20(3)12-18)32-27-10-9-23(35-27)13-22-7-8-24(34-22)15-30-33(5,6)17-25(36-30)14-28-26(21(4)38)16-29(32)37-28/h7-16,36,38H,17H2,1-6H3/b22-13-,25-14-,26-21-,30-15-,32-27+ |
| InChIKey | WMRSPVSOSNWGBC-WUGFKVLFSA-N |
| XLogP | 7.20 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|