C9H8BrN5O2 — CID 135510775
4-amino-N'-(3-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135510775) has the molecular formula C9H8BrN5O2 and a molecular weight of 298.10 g/mol. Its IUPAC name is 4-amino-N'-(3-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-(3-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135510775 |
| Molecular Formula | C9H8BrN5O2 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4-amino-N'-(3-bromophenyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | Nc1nonc1/C(=N/c1cccc(Br)c1)NO |
| InChI | InChI=1S/C9H8BrN5O2/c10-5-2-1-3-6(4-5)12-9(13-16)7-8(11)15-17-14-7/h1-4,16H,(H2,11,15)(H,12,13) |
| InChIKey | HVSMGKDKCTVBDZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|