C14H10N6O — CID 135511368
1-oxido-7-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,2,4-benzotriazin-1-ium-3-amine (PubChem CID 135511368) has the molecular formula C14H10N6O and a molecular weight of 278.28 g/mol. Its IUPAC name is 1-oxido-7-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,2,4-benzotriazin-1-ium-3-amine.
| Compound Name | 1-oxido-7-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,2,4-benzotriazin-1-ium-3-amine |
|---|---|
| PubChem CID | 135511368 |
| Molecular Formula | C14H10N6O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-oxido-7-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,2,4-benzotriazin-1-ium-3-amine |
| SMILES | Nc1nc2ccc(-c3ccnc4[nH]ccc34)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C14H10N6O/c15-14-18-11-2-1-8(7-12(11)20(21)19-14)9-3-5-16-13-10(9)4-6-17-13/h1-7H,(H,16,17)(H2,15,18,19) |
| InChIKey | UNZMTLJYHRMEDR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|