C19H21N3O3S — CID 135512280
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-phenylpropyl)propanamide (PubChem CID 135512280) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-phenylpropyl)propanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 135512280 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(3-phenylpropyl)propanamide |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-14(19(23)20-13-7-10-15-8-3-2-4-9-15)21-18-16-11-5-6-12-17(16)26(24,25)22-18/h2-6,8-9,11-12,14H,7,10,13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | LKPAEKSKSXKYCY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|