C10H11Cl2N3O3 — CID 135512313
1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-methoxyiminomethyl]urea (PubChem CID 135512313) has the molecular formula C10H11Cl2N3O3 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-methoxyiminomethyl]urea.
| Compound Name | 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-methoxyiminomethyl]urea |
|---|---|
| PubChem CID | 135512313 |
| Molecular Formula | C10H11Cl2N3O3 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methoxy]-3-[(E)-methoxyiminomethyl]urea |
| SMILES | CO/N=C/NC(=O)NOCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O3/c1-17-14-6-13-10(16)15-18-5-7-8(11)3-2-4-9(7)12/h2-4,6H,5H2,1H3,(H2,13,14,15,16) |
| InChIKey | KXRDHVNPUYEBHT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|