C10H11Cl2N3OS — CID 3742423
1-[[(2,4-dichlorophenyl)methoxyamino]methylidene]-3-methylthiourea (PubChem CID 3742423) has the molecular formula C10H11Cl2N3OS and a molecular weight of 292.19 g/mol. Its IUPAC name is 1-[[(2,4-dichlorophenyl)methoxyamino]methylidene]-3-methylthiourea.
| Compound Name | 1-[[(2,4-dichlorophenyl)methoxyamino]methylidene]-3-methylthiourea |
|---|---|
| PubChem CID | 3742423 |
| Molecular Formula | C10H11Cl2N3OS |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 1-[[(2,4-dichlorophenyl)methoxyamino]methylidene]-3-methylthiourea |
| SMILES | CNC(=S)N=CNOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3OS/c1-13-10(17)14-6-15-16-5-7-2-3-8(11)4-9(7)12/h2-4,6H,5H2,1H3,(H2,13,14,15,17) |
| InChIKey | QSIWCXBQJSETIC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|