C21H19BrN8O — CID 135513318
2-(4-bromophenyl)-4-[(E)-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-one (PubChem CID 135513318) has the molecular formula C21H19BrN8O and a molecular weight of 479.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(E)-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-(4-bromophenyl)-4-[(E)-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 135513318 |
| Molecular Formula | C21H19BrN8O |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(E)-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)diazenyl]phenyl]methylideneamino]-5-methyl-1,2,4-triazol-3-one |
| SMILES | Cc1n[nH]c(C)c1/N=N/c1ccc(/C=N/n2c(C)nn(-c3ccc(Br)cc3)c2=O)cc1 |
| InChI | InChI=1S/C21H19BrN8O/c1-13-20(14(2)25-24-13)27-26-18-8-4-16(5-9-18)12-23-29-15(3)28-30(21(29)31)19-10-6-17(22)7-11-19/h4-12H,1-3H3,(H,24,25)/b23-12+,27-26+ |
| InChIKey | VCUFMMQXHQXQDH-MAHHBBELSA-N |
| XLogP | 4.74 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|