C16H12BrN5O — CID 5099373
4-[(4-bromophenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one (PubChem CID 5099373) has the molecular formula C16H12BrN5O and a molecular weight of 370.21 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one.
| Compound Name | 4-[(4-bromophenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 5099373 |
| Molecular Formula | C16H12BrN5O |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 4-[(4-bromophenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccncc2)n(N=Cc2ccc(Br)cc2)c1=O |
| InChI | InChI=1S/C16H12BrN5O/c1-11-16(23)22(19-10-12-2-4-14(17)5-3-12)15(21-20-11)13-6-8-18-9-7-13/h2-10H,1H3 |
| InChIKey | DWPRGBGLLZZZCH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|