C16H11Br2N5O2 — CID 135710731
4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one (PubChem CID 135710731) has the molecular formula C16H11Br2N5O2 and a molecular weight of 465.11 g/mol. Its IUPAC name is 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one.
| Compound Name | 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135710731 |
| Molecular Formula | C16H11Br2N5O2 |
| Molecular Weight | 465.11 g/mol |
| Exact Mass | 462.93 |
| IUPAC Name | 4-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-6-methyl-3-pyridin-4-yl-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccncc2)n(/N=C/c2cc(Br)cc(Br)c2O)c1=O |
| InChI | InChI=1S/C16H11Br2N5O2/c1-9-16(25)23(15(22-21-9)10-2-4-19-5-3-10)20-8-11-6-12(17)7-13(18)14(11)24/h2-8,24H,1H3/b20-8+ |
| InChIKey | IULPGPWNLACXDP-DNTJNYDQSA-N |
| XLogP | 3.12 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|