C21H16N4O3 — CID 135513968
4-[(2E)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylphthalazin-1-one (PubChem CID 135513968) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-[(2E)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylphthalazin-1-one.
| Compound Name | 4-[(2E)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylphthalazin-1-one |
|---|---|
| PubChem CID | 135513968 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[(2E)-2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-phenylphthalazin-1-one |
| SMILES | O=c1c2ccccc2c(N/N=C/c2ccc(O)c(O)c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H16N4O3/c26-18-11-10-14(12-19(18)27)13-22-23-20-16-8-4-5-9-17(16)21(28)25(24-20)15-6-2-1-3-7-15/h1-13,26-27H,(H,23,24)/b22-13+ |
| InChIKey | WIKNEDCUOUBAOY-LPYMAVHISA-N |
| XLogP | 3.24 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|