C33H41N5O10 — CID 135514513
[(2R,3R,4R,5R)-5-[8-(4-formylphenyl)-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 135514513) has the molecular formula C33H41N5O10 and a molecular weight of 667.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[8-(4-formylphenyl)-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-[8-(4-formylphenyl)-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 135514513 |
| Molecular Formula | C33H41N5O10 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[8-(4-formylphenyl)-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)Nc1nc2c(nc(-c3ccc(C=O)cc3)n2[C@@H]2O[C@H](COC(=O)C(C)C)[C@@H](OC(=O)C(C)C)[C@H]2OC(=O)C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C33H41N5O10/c1-15(2)27(40)36-33-35-26-22(28(41)37-33)34-25(20-11-9-19(13-39)10-12-20)38(26)29-24(48-32(44)18(7)8)23(47-31(43)17(5)6)21(46-29)14-45-30(42)16(3)4/h9-13,15-18,21,23-24,29H,14H2,1-8H3,(H2,35,36,37,40,41)/t21-,23-,24-,29-/m1/s1 |
| InChIKey | WDYBENJYGOYSFE-LQLFOZJWSA-N |
| XLogP | 3.43 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|