C27H40N5O9+ — CID 135428416
[(2R,3R,4R,5R)-5-[7-methyl-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-ium-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 135428416) has the molecular formula C27H40N5O9+ and a molecular weight of 578.64 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[7-methyl-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-ium-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-[7-methyl-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-ium-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 135428416 |
| Molecular Formula | C27H40N5O9+ |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[7-methyl-2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-ium-9-yl]-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)Nc1nc2c(c(=O)[nH]1)n(C)c[n+]2[C@@H]1O[C@H](COC(=O)C(C)C)[C@@H](OC(=O)C(C)C)[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C27H39N5O9/c1-12(2)21(33)29-27-28-20-17(22(34)30-27)31(9)11-32(20)23-19(41-26(37)15(7)8)18(40-25(36)14(5)6)16(39-23)10-38-24(35)13(3)4/h11-16,18-19,23H,10H2,1-9H3,(H-,28,29,30,33,34)/p+1/t16-,18-,19-,23-/m1/s1 |
| InChIKey | PUOKYFHNMAYTEV-DYVMYPEFSA-O |
| XLogP | 1.38 |
| TPSA | 171.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|