C21H22N6O14P- — CID 166446034
[(2R,5R)-3,4-dihydroxy-5-[7-methyl-2-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]-6-oxo-1H-purin-9-ium-9-yl]oxolan-2-yl]methyl phosphate (PubChem CID 166446034) has the molecular formula C21H22N6O14P- and a molecular weight of 613.41 g/mol. Its IUPAC name is [(2R,5R)-3,4-dihydroxy-5-[7-methyl-2-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]-6-oxo-1H-purin-9-ium-9-yl]oxolan-2-yl]methyl phosphate.
| Compound Name | [(2R,5R)-3,4-dihydroxy-5-[7-methyl-2-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]-6-oxo-1H-purin-9-ium-9-yl]oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 166446034 |
| Molecular Formula | C21H22N6O14P- |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.09 |
| IUPAC Name | [(2R,5R)-3,4-dihydroxy-5-[7-methyl-2-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]-6-oxo-1H-purin-9-ium-9-yl]oxolan-2-yl]methyl phosphate |
| SMILES | CC(OC(=O)Nc1nc2c(c(=O)[nH]1)n(C)c[n+]2[C@@H]1O[C@H](COP(=O)([O-])[O-])C(O)C1O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C21H23N6O14P/c1-8(9-3-11-12(38-7-37-11)4-10(9)27(32)33)40-21(31)24-20-22-17-14(18(30)23-20)25(2)6-26(17)19-16(29)15(28)13(41-19)5-39-42(34,35)36/h3-4,6,8,13,15-16,19,28-29H,5,7H2,1-2H3,(H3-,22,23,24,30,31,34,35,36)/p-1/t8?,13-,15?,16?,19-/m1/s1 |
| InChIKey | SETIDVVLPALSTI-CDCHXZLHSA-M |
| XLogP | -2.04 |
| TPSA | 276.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|