C17H26N5O6P — CID 135515185
2-amino-9-[(2S,3R,6R)-6-di(propan-2-yloxy)phosphoryl-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]-1H-purin-6-one (PubChem CID 135515185) has the molecular formula C17H26N5O6P and a molecular weight of 427.40 g/mol. Its IUPAC name is 2-amino-9-[(2S,3R,6R)-6-di(propan-2-yloxy)phosphoryl-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2S,3R,6R)-6-di(propan-2-yloxy)phosphoryl-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135515185 |
| Molecular Formula | C17H26N5O6P |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-amino-9-[(2S,3R,6R)-6-di(propan-2-yloxy)phosphoryl-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]-1H-purin-6-one |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@@H]1C=C[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H](CO)O1 |
| InChI | InChI=1S/C17H26N5O6P/c1-9(2)27-29(25,28-10(3)4)13-6-5-11(12(7-23)26-13)22-8-19-14-15(22)20-17(18)21-16(14)24/h5-6,8-13,23H,7H2,1-4H3,(H3,18,20,21,24)/t11-,12-,13-/m1/s1 |
| InChIKey | NPJSLILVWZUFPG-JHJVBQTASA-N |
| XLogP | 1.56 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|