About 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole
5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 135518262) has the molecular formula C22H18N2O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 135518262 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | Cc1cccc2c(-c3ccccc3)c(C3=NOC(c4ccco4)C3)[nH]c12 |
| InChI | InChI=1S/C22H18N2O2/c1-14-7-5-10-16-20(15-8-3-2-4-9-15)22(23-21(14)16)17-13-19(26-24-17)18-11-6-12-25-18/h2-12,19,23H,13H2,1H3 |
| InChIKey | XRUURJXVLFNTMZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole (CID 135518262) is 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole is Cc1cccc2c(-c3ccccc3)c(C3=NOC(c4ccco4)C3)[nH]c12.
What is the InChIKey of 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole?
The InChIKey is XRUURJXVLFNTMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O2/c1-14-7-5-10-16-20(15-8-3-2-4-9-15)22(23-21(14)16)17-13-19(26-24-17)18-11-6-12-25-18/h2-12,19,23H,13H2,1H3.
What are the key properties of 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole?
5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole has a molecular weight of 342.40 g/mol, XLogP of 5.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-3-(7-methyl-3-phenyl-1H-indol-2-yl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 135518262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).