C16H11NO4 — CID 40570041
3-[(5R)-5-(furan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]chromen-2-one (PubChem CID 40570041) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-[(5R)-5-(furan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]chromen-2-one.
| Compound Name | 3-[(5R)-5-(furan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 40570041 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-[(5R)-5-(furan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=NO[C@@H](c2ccco2)C1 |
| InChI | InChI=1S/C16H11NO4/c18-16-11(8-10-4-1-2-5-13(10)20-16)12-9-15(21-17-12)14-6-3-7-19-14/h1-8,15H,9H2/t15-/m1/s1 |
| InChIKey | DMQBECUNFMUMKL-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 64.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|