C30H22N2O2 — CID 171346824
3-[5-(3,4-diphenylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]chromen-2-one (PubChem CID 171346824) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[5-(3,4-diphenylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]chromen-2-one.
| Compound Name | 3-[5-(3,4-diphenylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]chromen-2-one |
|---|---|
| PubChem CID | 171346824 |
| Molecular Formula | C30H22N2O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[5-(3,4-diphenylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=NNC(c2ccc(-c3ccccc3)c(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C30H22N2O2/c33-30-26(18-23-13-7-8-14-29(23)34-30)28-19-27(31-32-28)22-15-16-24(20-9-3-1-4-10-20)25(17-22)21-11-5-2-6-12-21/h1-18,27,31H,19H2 |
| InChIKey | RFHXNIKPSZCKHY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|