C20H15N3O4S — CID 7832263
3-[(5R)-5-(1,3-benzodioxol-5-yl)-3-sulfanylidene-2,4,5,6-tetrahydro-1,2,4-triazepin-7-yl]chromen-2-one (PubChem CID 7832263) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-[(5R)-5-(1,3-benzodioxol-5-yl)-3-sulfanylidene-2,4,5,6-tetrahydro-1,2,4-triazepin-7-yl]chromen-2-one.
| Compound Name | 3-[(5R)-5-(1,3-benzodioxol-5-yl)-3-sulfanylidene-2,4,5,6-tetrahydro-1,2,4-triazepin-7-yl]chromen-2-one |
|---|---|
| PubChem CID | 7832263 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[(5R)-5-(1,3-benzodioxol-5-yl)-3-sulfanylidene-2,4,5,6-tetrahydro-1,2,4-triazepin-7-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1C1=NNC(=S)N[C@@H](c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C20H15N3O4S/c24-19-13(7-12-3-1-2-4-16(12)27-19)15-9-14(21-20(28)23-22-15)11-5-6-17-18(8-11)26-10-25-17/h1-8,14H,9-10H2,(H2,21,23,28)/t14-/m1/s1 |
| InChIKey | CTFYODMGFXIIGG-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|