About 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one
4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one (PubChem CID 135069644) has the molecular formula C21H19NO
and a molecular weight of 301.39 g/mol. Its IUPAC name is 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one.
Molecular Properties
| Compound Name | 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one |
| PubChem CID | 135069644 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one |
| SMILES | Cc1cccc2c3c([nH]c12)C(c1ccccc1)=CC(=O)CC3C |
| InChI | InChI=1S/C21H19NO/c1-13-7-6-10-17-19-14(2)11-16(23)12-18(21(19)22-20(13)17)15-8-4-3-5-9-15/h3-10,12,14,22H,11H2,1-2H3 |
| InChIKey | HAVMEOJCJGDROQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one?
The IUPAC name of 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one (CID 135069644) is 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one.
What is the SMILES notation for 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one?
The canonical SMILES for 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one is Cc1cccc2c3c([nH]c12)C(c1ccccc1)=CC(=O)CC3C.
What is the InChIKey of 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one?
The InChIKey is HAVMEOJCJGDROQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO/c1-13-7-6-10-17-19-14(2)11-16(23)12-18(21(19)22-20(13)17)15-8-4-3-5-9-15/h3-10,12,14,22H,11H2,1-2H3.
What are the key properties of 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one?
4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one has a molecular weight of 301.39 g/mol, XLogP of 4.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dimethyl-6-phenyl-9,10-dihydro-5H-cyclohepta[b]indol-8-one is sourced from PubChem (CID 135069644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).