C20H13FN4O3 — CID 135520893
4-(3,4-dihydroxyphenyl)-1-(4-fluorophenyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 135520893) has the molecular formula C20H13FN4O3 and a molecular weight of 376.35 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenyl)-1-(4-fluorophenyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 4-(3,4-dihydroxyphenyl)-1-(4-fluorophenyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 135520893 |
| Molecular Formula | C20H13FN4O3 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-1-(4-fluorophenyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2[nH]c(=O)c(C#N)c(-c3ccc(O)c(O)c3)c12 |
| InChI | InChI=1S/C20H13FN4O3/c1-10-17-18(11-2-7-15(26)16(27)8-11)14(9-22)20(28)23-19(17)25(24-10)13-5-3-12(21)4-6-13/h2-8,26-27H,1H3,(H,23,28) |
| InChIKey | QSVHVNSGLKXVBF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|