C18H25N5O3 — CID 135526567
7-methyl-N-(3-morpholin-4-ylpropyl)-1,4-dioxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazine-1,4-diium-3-amine (PubChem CID 135526567) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 7-methyl-N-(3-morpholin-4-ylpropyl)-1,4-dioxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazine-1,4-diium-3-amine.
| Compound Name | 7-methyl-N-(3-morpholin-4-ylpropyl)-1,4-dioxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135526567 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 7-methyl-N-(3-morpholin-4-ylpropyl)-1,4-dioxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazine-1,4-diium-3-amine |
| SMILES | CC1Cc2cc3c(cc2C1)[n+]([O-])c(NCCCN1CCOCC1)n[n+]3[O-] |
| InChI | InChI=1S/C18H25N5O3/c1-13-9-14-11-16-17(12-15(14)10-13)23(25)20-18(22(16)24)19-3-2-4-21-5-7-26-8-6-21/h11-13H,2-10H2,1H3,(H,19,20) |
| InChIKey | URTWQJURFIBEDK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|