C20H23N5O6S2 — CID 135535571
N-[2-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 135535571) has the molecular formula C20H23N5O6S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[2-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135535571 |
| Molecular Formula | C20H23N5O6S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[2-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]hydrazinyl]-2-oxoethyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NNC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H23N5O6S2/c1-14-7-9-15(10-8-14)33(30,31)25(2)13-19(27)23-22-18(26)11-12-21-20-16-5-3-4-6-17(16)32(28,29)24-20/h3-10H,11-13H2,1-2H3,(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | BXGNPASRHDNJFQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|