C19H26N10O8 — CID 135538651
2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one;1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 135538651) has the molecular formula C19H26N10O8 and a molecular weight of 522.48 g/mol. Its IUPAC name is 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one;1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one;1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135538651 |
| Molecular Formula | C19H26N10O8 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-amino-9-(1,3-dihydroxypropan-2-yloxymethyl)-1H-purin-6-one;1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O.Nc1nc2c(ncn2COC(CO)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N5O4.C9H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8;10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,6-8,16H,2,4H2,1H3,(H,12,17,18);3,5,15-16H,1-2,4H2,(H3,10,12,13,17)/t6-,7+,8+;/m0./s1 |
| InChIKey | OGCFPGMCKGCCAE-HNPMAXIBSA-N |
| XLogP | -2.17 |
| TPSA | 272.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|