C23H18BrN5O2 — CID 135538935
4-bromo-2-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-6-methoxyphenol (PubChem CID 135538935) has the molecular formula C23H18BrN5O2 and a molecular weight of 476.33 g/mol. Its IUPAC name is 4-bromo-2-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-6-methoxyphenol.
| Compound Name | 4-bromo-2-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135538935 |
| Molecular Formula | C23H18BrN5O2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 4-bromo-2-[[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]methyl]-6-methoxyphenol |
| SMILES | COc1cc(Br)cc(C=NNc2nnc(-c3ccccc3)c(-c3ccccc3)n2)c1O |
| InChI | InChI=1S/C23H18BrN5O2/c1-31-19-13-18(24)12-17(22(19)30)14-25-28-23-26-20(15-8-4-2-5-9-15)21(27-29-23)16-10-6-3-7-11-16/h2-14,30H,1H3,(H,26,28,29) |
| InChIKey | SNEDDWDWWOOPRJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|