C30H32N2O6 — CID 135540557
2-diazo-1-[(4R,6S)-2-methyl-5-phenylmethoxy-4,6-bis(phenylmethoxymethyl)-1,3-dioxan-2-yl]ethanone (PubChem CID 135540557) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is 2-diazo-1-[(4R,6S)-2-methyl-5-phenylmethoxy-4,6-bis(phenylmethoxymethyl)-1,3-dioxan-2-yl]ethanone.
| Compound Name | 2-diazo-1-[(4R,6S)-2-methyl-5-phenylmethoxy-4,6-bis(phenylmethoxymethyl)-1,3-dioxan-2-yl]ethanone |
|---|---|
| PubChem CID | 135540557 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 2-diazo-1-[(4R,6S)-2-methyl-5-phenylmethoxy-4,6-bis(phenylmethoxymethyl)-1,3-dioxan-2-yl]ethanone |
| SMILES | CC1(C(=O)C=[N+]=[N-])O[C@@H](COCc2ccccc2)C(OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C30H32N2O6/c1-30(28(33)17-32-31)37-26(21-34-18-23-11-5-2-6-12-23)29(36-20-25-15-9-4-10-16-25)27(38-30)22-35-19-24-13-7-3-8-14-24/h2-17,26-27,29H,18-22H2,1H3/t26-,27+,29?,30? |
| InChIKey | WZKCBRGPPFJQRX-ZZHQNZCASA-N |
| XLogP | 4.38 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|