C18H11Br2N3O2 — CID 135542110
(E)-2-(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)-3-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 135542110) has the molecular formula C18H11Br2N3O2 and a molecular weight of 461.11 g/mol. Its IUPAC name is (E)-2-(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)-3-(4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)-3-(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135542110 |
| Molecular Formula | C18H11Br2N3O2 |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | (E)-2-(6,8-dibromo-4-oxo-3H-quinazolin-2-yl)-3-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2nc3c(Br)cc(Br)cc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C18H11Br2N3O2/c1-25-13-4-2-10(3-5-13)6-11(9-21)17-22-16-14(18(24)23-17)7-12(19)8-15(16)20/h2-8H,1H3,(H,22,23,24)/b11-6+ |
| InChIKey | OECNJCGWRQZZKZ-IZZDOVSWSA-N |
| XLogP | 4.52 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|