C21H32N3O2S+ — CID 135542303
diethyl-[2-(4-hydroxy-6-oxo-5-pentyl-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium (PubChem CID 135542303) has the molecular formula C21H32N3O2S+ and a molecular weight of 390.57 g/mol. Its IUPAC name is diethyl-[2-(4-hydroxy-6-oxo-5-pentyl-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium.
| Compound Name | diethyl-[2-(4-hydroxy-6-oxo-5-pentyl-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 135542303 |
| Molecular Formula | C21H32N3O2S+ |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | diethyl-[2-(4-hydroxy-6-oxo-5-pentyl-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium |
| SMILES | CCCCCc1c(O)nc(SCC[NH+](CC)CC)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H31N3O2S/c1-4-7-9-14-18-19(25)22-21(27-16-15-23(5-2)6-3)24(20(18)26)17-12-10-8-11-13-17/h8,10-13,25H,4-7,9,14-16H2,1-3H3/p+1 |
| InChIKey | KEADAPGGASCNNH-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|