C23H36ClN3O2S — CID 135959632
diethyl-[2-(5-heptyl-4-hydroxy-6-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium chloride (PubChem CID 135959632) has the molecular formula C23H36ClN3O2S and a molecular weight of 454.08 g/mol. Its IUPAC name is diethyl-[2-(5-heptyl-4-hydroxy-6-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium chloride.
| Compound Name | diethyl-[2-(5-heptyl-4-hydroxy-6-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium chloride |
|---|---|
| PubChem CID | 135959632 |
| Molecular Formula | C23H36ClN3O2S |
| Molecular Weight | 454.08 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | diethyl-[2-(5-heptyl-4-hydroxy-6-oxo-1-phenylpyrimidin-2-yl)sulfanylethyl]azanium chloride |
| SMILES | CCCCCCCc1c(O)nc(SCC[NH+](CC)CC)n(-c2ccccc2)c1=O.[Cl-] |
| InChI | InChI=1S/C23H35N3O2S.ClH/c1-4-7-8-9-13-16-20-21(27)24-23(29-18-17-25(5-2)6-3)26(22(20)28)19-14-11-10-12-15-19;/h10-12,14-15,27H,4-9,13,16-18H2,1-3H3;1H |
| InChIKey | LAIFGRTUKDAKMR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.08 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|