C21H30ClN3O3S — CID 137104146
6-hydroxy-2-(2-morpholin-4-ylethylsulfanyl)-5-pentyl-3-phenylpyrimidin-4-one;hydrochloride (PubChem CID 137104146) has the molecular formula C21H30ClN3O3S and a molecular weight of 440.01 g/mol. Its IUPAC name is 6-hydroxy-2-(2-morpholin-4-ylethylsulfanyl)-5-pentyl-3-phenylpyrimidin-4-one;hydrochloride.
| Compound Name | 6-hydroxy-2-(2-morpholin-4-ylethylsulfanyl)-5-pentyl-3-phenylpyrimidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 137104146 |
| Molecular Formula | C21H30ClN3O3S |
| Molecular Weight | 440.01 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 6-hydroxy-2-(2-morpholin-4-ylethylsulfanyl)-5-pentyl-3-phenylpyrimidin-4-one;hydrochloride |
| SMILES | CCCCCc1c(O)nc(SCCN2CCOCC2)n(-c2ccccc2)c1=O.Cl |
| InChI | InChI=1S/C21H29N3O3S.ClH/c1-2-3-5-10-18-19(25)22-21(28-16-13-23-11-14-27-15-12-23)24(20(18)26)17-8-6-4-7-9-17;/h4,6-9,25H,2-3,5,10-16H2,1H3;1H |
| InChIKey | FWLWDIDXSRMYJT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|