C26H23F3N4O — CID 135547640
N-[(E)-[5-butyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 135547640) has the molecular formula C26H23F3N4O and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[(E)-[5-butyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[5-butyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135547640 |
| Molecular Formula | C26H23F3N4O |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[(E)-[5-butyl-2-[4-(trifluoromethyl)phenyl]-1H-indol-3-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | CCCCc1ccc2[nH]c(-c3ccc(C(F)(F)F)cc3)c(/C=N/NC(=O)c3cccnc3)c2c1 |
| InChI | InChI=1S/C26H23F3N4O/c1-2-3-5-17-7-12-23-21(14-17)22(16-31-33-25(34)19-6-4-13-30-15-19)24(32-23)18-8-10-20(11-9-18)26(27,28)29/h4,6-16,32H,2-3,5H2,1H3,(H,33,34)/b31-16+ |
| InChIKey | HHSMJHNHTWUIKF-WCMJOSRZSA-N |
| XLogP | 6.36 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|