C23H30N6O2 — CID 135550662
2-amino-1-[4-[4-[(7-hydroxy-8-propan-2-yl-5,6-dihydroquinazolin-2-yl)amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 135550662) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-amino-1-[4-[4-[(7-hydroxy-8-propan-2-yl-5,6-dihydroquinazolin-2-yl)amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-[4-[(7-hydroxy-8-propan-2-yl-5,6-dihydroquinazolin-2-yl)amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 135550662 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-amino-1-[4-[4-[(7-hydroxy-8-propan-2-yl-5,6-dihydroquinazolin-2-yl)amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(C)C1=C(O)CCc2cnc(Nc3ccc(N4CCN(C(=O)CN)CC4)cc3)nc21 |
| InChI | InChI=1S/C23H30N6O2/c1-15(2)21-19(30)8-3-16-14-25-23(27-22(16)21)26-17-4-6-18(7-5-17)28-9-11-29(12-10-28)20(31)13-24/h4-7,14-15,30H,3,8-13,24H2,1-2H3,(H,25,26,27) |
| InChIKey | NIFHROGLKGXLKN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|