About (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one
(3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 135556870) has the molecular formula C17H14Cl2N4O
and a molecular weight of 361.23 g/mol. Its IUPAC name is (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one |
| PubChem CID | 135556870 |
| Molecular Formula | C17H14Cl2N4O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | CN(C)c1ccc(C=N/N=C2\C(=O)Nc3c(Cl)cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H14Cl2N4O/c1-23(2)12-5-3-10(4-6-12)9-20-22-16-13-7-11(18)8-14(19)15(13)21-17(16)24/h3-9H,1-2H3,(H,21,22,24) |
| InChIKey | JDPDRMRHHQTAMK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_J(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one (CID 135556870) is (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one is CN(C)c1ccc(C=N/N=C2\C(=O)Nc3c(Cl)cc(Cl)cc32)cc1.
What is the InChIKey of (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one?
The InChIKey is JDPDRMRHHQTAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N4O/c1-23(2)12-5-3-10(4-6-12)9-20-22-16-13-7-11(18)8-14(19)15(13)21-17(16)24/h3-9H,1-2H3,(H,21,22,24).
What are the key properties of (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one?
(3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one has a molecular weight of 361.23 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5,7-dichloro-3-[[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-1H-indol-2-one is sourced from PubChem (CID 135556870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).