C21H13Cl2N3O4S — CID 135676302
[4-[(E)-[(E)-(5,7-dichloro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 135676302) has the molecular formula C21H13Cl2N3O4S and a molecular weight of 474.33 g/mol. Its IUPAC name is [4-[(E)-[(E)-(5,7-dichloro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-[(E)-(5,7-dichloro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 135676302 |
| Molecular Formula | C21H13Cl2N3O4S |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | [4-[(E)-[(E)-(5,7-dichloro-2-oxo-1H-indol-3-ylidene)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=N/N=C2/C(=O)Nc3c(Cl)cc(Cl)cc32)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C21H13Cl2N3O4S/c1-29-16-7-11(4-5-15(16)30-21(28)17-3-2-6-31-17)10-24-26-19-13-8-12(22)9-14(23)18(13)25-20(19)27/h2-10H,1H3,(H,25,26,27)/b24-10+ |
| InChIKey | RFDIRLAMIGRNEA-YSURURNPSA-N |
| XLogP | 5.06 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|