C9H16N2 — CID 135563810
N'-(4,4-dimethylcyclohexyl)methanediimine (PubChem CID 135563810) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-(4,4-dimethylcyclohexyl)methanediimine.
| Compound Name | N'-(4,4-dimethylcyclohexyl)methanediimine |
|---|---|
| PubChem CID | 135563810 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-(4,4-dimethylcyclohexyl)methanediimine |
| SMILES | CC1(C)CCC(N=C=N)CC1 |
| InChI | InChI=1S/C9H16N2/c1-9(2)5-3-8(4-6-9)11-7-10/h8,10H,3-6H2,1-2H3 |
| InChIKey | FLNNNKIURSGQSN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|