About N'-(4,4-dimethylcyclohexyl)methanediimine
N'-(4,4-dimethylcyclohexyl)methanediimine (PubChem CID 135563810) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-(4,4-dimethylcyclohexyl)methanediimine.
Molecular Properties
| Compound Name | N'-(4,4-dimethylcyclohexyl)methanediimine |
| PubChem CID | 135563810 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-(4,4-dimethylcyclohexyl)methanediimine |
| SMILES | CC1(C)CCC(N=C=N)CC1 |
| InChI | InChI=1S/C9H16N2/c1-9(2)5-3-8(4-6-9)11-7-10/h8,10H,3-6H2,1-2H3 |
| InChIKey | FLNNNKIURSGQSN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,4-dimethylcyclohexyl)methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,4-dimethylcyclohexyl)methanediimine?
The IUPAC name of N'-(4,4-dimethylcyclohexyl)methanediimine (CID 135563810) is N'-(4,4-dimethylcyclohexyl)methanediimine.
What is the SMILES notation for N'-(4,4-dimethylcyclohexyl)methanediimine?
The canonical SMILES for N'-(4,4-dimethylcyclohexyl)methanediimine is CC1(C)CCC(N=C=N)CC1.
What is the InChIKey of N'-(4,4-dimethylcyclohexyl)methanediimine?
The InChIKey is FLNNNKIURSGQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-9(2)5-3-8(4-6-9)11-7-10/h8,10H,3-6H2,1-2H3.
What are the key properties of N'-(4,4-dimethylcyclohexyl)methanediimine?
N'-(4,4-dimethylcyclohexyl)methanediimine has a molecular weight of 152.24 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,4-dimethylcyclohexyl)methanediimine is sourced from PubChem (CID 135563810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).