C17H13N3O5 — CID 135563988
5'-[(2-nitrophenyl)methylideneamino]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (PubChem CID 135563988) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 5'-[(2-nitrophenyl)methylideneamino]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
| Compound Name | 5'-[(2-nitrophenyl)methylideneamino]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 135563988 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 5'-[(2-nitrophenyl)methylideneamino]spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccc(/N=C/c3ccccc3[N+](=O)[O-])cc2C12OCCO2 |
| InChI | InChI=1S/C17H13N3O5/c21-16-17(24-7-8-25-17)13-9-12(5-6-14(13)19-16)18-10-11-3-1-2-4-15(11)20(22)23/h1-6,9-10H,7-8H2,(H,19,21)/b18-10+ |
| InChIKey | ZZKMLHLGBYIICR-VCHYOVAHSA-N |
| XLogP | 2.50 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|