C11H19N3O2 — CID 135564835
(5R)-5-ethyl-6-imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 135564835) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is (5R)-5-ethyl-6-imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (5R)-5-ethyl-6-imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 135564835 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (5R)-5-ethyl-6-imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\NC(=O)NC(=O)[C@]1(CC)[C@@H](C)CCC |
| InChI | InChI=1S/C11H19N3O2/c1-4-6-7(3)11(5-2)8(12)13-10(16)14-9(11)15/h7H,4-6H2,1-3H3,(H3,12,13,14,15,16)/t7-,11+/m0/s1 |
| InChIKey | CLQPRFRZKLHZSC-WRWORJQWSA-N |
| XLogP | 1.64 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|