C29H47N7O5 — CID 135573619
(E)-N-[2-[[6-[(Z)-3,5-dihydropurin-6-ylideneamino]-4,5-dihydroxy-2-methyloxan-3-yl]amino]-2-oxoethyl]-14-methylpentadec-11-enamide (PubChem CID 135573619) has the molecular formula C29H47N7O5 and a molecular weight of 573.74 g/mol. Its IUPAC name is (E)-N-[2-[[6-[(Z)-3,5-dihydropurin-6-ylideneamino]-4,5-dihydroxy-2-methyloxan-3-yl]amino]-2-oxoethyl]-14-methylpentadec-11-enamide.
| Compound Name | (E)-N-[2-[[6-[(Z)-3,5-dihydropurin-6-ylideneamino]-4,5-dihydroxy-2-methyloxan-3-yl]amino]-2-oxoethyl]-14-methylpentadec-11-enamide |
|---|---|
| PubChem CID | 135573619 |
| Molecular Formula | C29H47N7O5 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | (E)-N-[2-[[6-[(Z)-3,5-dihydropurin-6-ylideneamino]-4,5-dihydroxy-2-methyloxan-3-yl]amino]-2-oxoethyl]-14-methylpentadec-11-enamide |
| SMILES | CC(C)C/C=C/CCCCCCCCCC(=O)NCC(=O)NC1C(C)OC(/N=C2\N=CNC3=NC=NC32)C(O)C1O |
| InChI | InChI=1S/C29H47N7O5/c1-19(2)14-12-10-8-6-4-5-7-9-11-13-15-21(37)30-16-22(38)35-23-20(3)41-29(26(40)25(23)39)36-28-24-27(32-17-31-24)33-18-34-28/h10,12,17-20,23-26,29,39-40H,4-9,11,13-16H2,1-3H3,(H,30,37)(H,35,38)(H,31,32,33,34,36)/b12-10+ |
| InChIKey | PMIXOCTUQKATDX-ZRDIBKRKSA-N |
| XLogP | 2.01 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|