C16H11BrN6O — CID 135580536
2-[(E)-C-(8-bromo-5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]phenol (PubChem CID 135580536) has the molecular formula C16H11BrN6O and a molecular weight of 383.21 g/mol. Its IUPAC name is 2-[(E)-C-(8-bromo-5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]phenol.
| Compound Name | 2-[(E)-C-(8-bromo-5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]phenol |
|---|---|
| PubChem CID | 135580536 |
| Molecular Formula | C16H11BrN6O |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[(E)-C-(8-bromo-5H-[1,2,4]triazino[5,6-b]indol-3-yl)carbonohydrazonoyl]phenol |
| SMILES | N/N=C(/c1nnc2c(n1)[nH]c1ccc(Br)cc12)c1ccccc1O |
| InChI | InChI=1S/C16H11BrN6O/c17-8-5-6-11-10(7-8)14-15(19-11)20-16(23-22-14)13(21-18)9-3-1-2-4-12(9)24/h1-7,24H,18H2,(H,19,20,23)/b21-13+ |
| InChIKey | NNKKLCXDABODBN-FYJGNVAPSA-N |
| XLogP | 2.69 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|