C22H26BrN3O4 — CID 135580640
2-[4-bromo-2-(piperidin-1-ylmethyl)phenoxy]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135580640) has the molecular formula C22H26BrN3O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is 2-[4-bromo-2-(piperidin-1-ylmethyl)phenoxy]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-bromo-2-(piperidin-1-ylmethyl)phenoxy]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135580640 |
| Molecular Formula | C22H26BrN3O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 2-[4-bromo-2-(piperidin-1-ylmethyl)phenoxy]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccc(Br)cc2CN2CCCCC2)ccc1O |
| InChI | InChI=1S/C22H26BrN3O4/c1-29-21-11-16(5-7-19(21)27)13-24-25-22(28)15-30-20-8-6-18(23)12-17(20)14-26-9-3-2-4-10-26/h5-8,11-13,27H,2-4,9-10,14-15H2,1H3,(H,25,28)/b24-13+ |
| InChIKey | XNMXFDXWFQENFZ-ZMOGYAJESA-N |
| XLogP | 3.68 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|