C17H25N4O3S+ — CID 135584831
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]propanamide (PubChem CID 135584831) has the molecular formula C17H25N4O3S+ and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 135584831 |
| Molecular Formula | C17H25N4O3S+ |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]propanamide |
| SMILES | CC[NH+]1CCC[C@H]1CNC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H24N4O3S/c1-2-21-11-5-6-13(21)12-19-16(22)9-10-18-17-14-7-3-4-8-15(14)25(23,24)20-17/h3-4,7-8,13H,2,5-6,9-12H2,1H3,(H,18,20)(H,19,22)/p+1/t13-/m0/s1 |
| InChIKey | OQZQJTAQJBFPNI-ZDUSSCGKSA-O |
| XLogP | -0.70 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|