C20H25N5O2S — CID 135588321
N-[(E)-1-[3-(diethylaminomethyl)-4-hydroxyphenyl]ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (PubChem CID 135588321) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[(E)-1-[3-(diethylaminomethyl)-4-hydroxyphenyl]ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
| Compound Name | N-[(E)-1-[3-(diethylaminomethyl)-4-hydroxyphenyl]ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
|---|---|
| PubChem CID | 135588321 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[(E)-1-[3-(diethylaminomethyl)-4-hydroxyphenyl]ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| SMILES | CCN(CC)Cc1cc(/C(C)=N/NC(=O)Cc2cn3ccsc3n2)ccc1O |
| InChI | InChI=1S/C20H25N5O2S/c1-4-24(5-2)12-16-10-15(6-7-18(16)26)14(3)22-23-19(27)11-17-13-25-8-9-28-20(25)21-17/h6-10,13,26H,4-5,11-12H2,1-3H3,(H,23,27)/b22-14+ |
| InChIKey | BQCUVQVOZFLSFL-HYARGMPZSA-N |
| XLogP | 3.03 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|