C13H12N4OS2 — CID 5143876
2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(1-thiophen-2-ylethylideneamino)acetamide (PubChem CID 5143876) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(1-thiophen-2-ylethylideneamino)acetamide.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(1-thiophen-2-ylethylideneamino)acetamide |
|---|---|
| PubChem CID | 5143876 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-N-(1-thiophen-2-ylethylideneamino)acetamide |
| SMILES | CC(=NNC(=O)Cc1cn2ccsc2n1)c1cccs1 |
| InChI | InChI=1S/C13H12N4OS2/c1-9(11-3-2-5-19-11)15-16-12(18)7-10-8-17-4-6-20-13(17)14-10/h2-6,8H,7H2,1H3,(H,16,18) |
| InChIKey | GVCUANQHFDPVBW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|