C13H11ClN4OS2 — CID 4989244
N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (PubChem CID 4989244) has the molecular formula C13H11ClN4OS2 and a molecular weight of 338.85 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
|---|---|
| PubChem CID | 4989244 |
| Molecular Formula | C13H11ClN4OS2 |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| SMILES | CC(=NNC(=O)Cc1cn2ccsc2n1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11ClN4OS2/c1-8(10-2-3-11(14)21-10)16-17-12(19)6-9-7-18-4-5-20-13(18)15-9/h2-5,7H,6H2,1H3,(H,17,19) |
| InChIKey | MHAMMCIKIQYTAZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|