C13H10F3N5O — CID 135590508
4-methyl-2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-1H-pyrimidin-6-one (PubChem CID 135590508) has the molecular formula C13H10F3N5O and a molecular weight of 309.25 g/mol. Its IUPAC name is 4-methyl-2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135590508 |
| Molecular Formula | C13H10F3N5O |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-methyl-2-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(Nc2nc3ccc(C(F)(F)F)cc3[nH]2)n1 |
| InChI | InChI=1S/C13H10F3N5O/c1-6-4-10(22)20-11(17-6)21-12-18-8-3-2-7(13(14,15)16)5-9(8)19-12/h2-5H,1H3,(H3,17,18,19,20,21,22) |
| InChIKey | WIXAAWABBIJRGT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |